Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 7-bromo-1,5-naphthyridine-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 7-bromo-1,5-naphthyridine-3-carboxylate is a high-purity organic compound commonly used in pharmaceutical and chemical research. This heterocyclic compound features a bromine atom at the 7-position and a methyl ester group at the 3-position, making it a versatile intermediate in the synthesis of bioactive molecules. Its structure and reactivity make it valuable for medicinal chemistry, particularly in developing compounds targeting nucleic acid interactions and enzyme inhibition. Methyl 7-bromo-1,5-naphthyridine-3-carboxylate is crucial for exploring novel therapeutic agents.
Catalog Number | L044741 |
CAS Number | 958334-24-2 |
Molecular Formula | C10H7BrN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 7-bromo-1,5-naphthyridine-3-carboxylate |
InChI | InChI=1S/C10H7BrN2O2/c1-15-10(14)6-2-8-9(12-4-6)3-7(11)5-13-8/h2-5H,1H3 |
InChIKey | HSKHAOKCHBJDBO-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC2=C(C=C(C=N2)Br)N=C1 |