For research use only. Not for therapeutic Use.
Methyl 7-chloro-1H-indole-5-carboxylate(Cat No.:L007591), is a chemical compound with a molecular structure featuring a chlorinated indole ring attached to a carboxylate group through a methyl ester linkage. This compound is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable building block in the creation of diverse organic molecules, especially in drug discovery efforts. Its specific structure allows for various chemical modifications, making it instrumental in the design and synthesis of potential pharmaceutical agents.
CAS Number | 256936-02-4 |
Molecular Formula | C10H8ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 7-chloro-1H-indole-5-carboxylate |
InChI | InChI=1S/C10H8ClNO2/c1-14-10(13)7-4-6-2-3-12-9(6)8(11)5-7/h2-5,12H,1H3 |
InChIKey | GXXVVVAPNVMAGE-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=C2C(=C1)C=CN2)Cl |