Methyl Carbamate-d3（Cat No.:S001139） is a deuterated version of Methyl Carbamate, where three hydrogen atoms are replaced with deuterium. This isotopic enhancement increases its stability and makes it particularly useful in the study of pesticide metabolism and environmental degradation. Employed primarily in toxicological and environmental research, Methyl Carbamate-d3 aids in tracing the transformation and fate of carbamate pesticides in ecosystems. It also serves as a valuable tool in developing analytical methods for detecting pesticide residues in food and environmental samples, ensuring more accurate and reliable results in safety assessments and regulatory compliance.
| Catalog Number | S001139 |
| CAS Number | 124522-32-3 |
| Molecular Formula | C2H2D3NO2 |
| Purity | 95% |
| IUPAC Name | trideuteriomethyl carbamate |
| InChI | InChI=1S/C2H5NO2/c1-5-2(3)4/h1H3,(H2,3,4)/i1D3 |
| InChIKey | GTCAXTIRRLKXRU-FIBGUPNXSA-N |
| SMILES | COC(=O)N |
