For research use only. Not for therapeutic Use.
As an organic synthetic raw material, methyl chloroacetate (Cat. No: R060543) can be used in the preparation of medicine, adhesive, surfactant, and solvent. In the pesticide, Methyl chloroacetate is mainly used for the synthesis of pesticide dimethoate, omethoate intermediates thiophosphate, thiophosphate, and chloroacetyl methylamine.
| Catalog Number | R060543 |
| CAS Number | 96-34-4 |
| Synonyms | 2-Chloroacetic Acid Methyl Ester; ?Chloroacetic Acid Methyl Ester; Methyl 2-Chloroacetate; Methyl Chloroacetate; Methyl Monochloracetate; Methyl Monochloroacetate; Methyl α-Chloroacetate; Monochloroacetic Acid Methyl Ester; NSC 2635 |
| Molecular Formula | C3H5ClO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl 2-chloroacetate |
| InChI | InChI=1S/C3H5ClO2/c1-6-3(5)2-4/h2H2,1H3 |
| InChIKey | QABLOFMHHSOFRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCl |
