For research use only. Not for therapeutic Use.
Methyl Cinnamate(Cat No.:R019123)is a naturally occurring ester found in plants like cinnamon and basil, known for its aromatic scent and flavor. It has various applications in the fragrance and food industries due to its sweet, spicy aroma. Beyond its sensory appeal, methyl cinnamate exhibits notable anti-inflammatory, antimicrobial, and antioxidant properties, making it valuable in pharmacological and cosmetic research. It’s studied for its potential skin-soothing and antimicrobial effects, supporting its use in skincare formulations. Methyl cinnamate also shows promise in agricultural research for its ability to repel certain pests naturally.
CAS Number | 103-26-4 |
Synonyms | 3-Phenyl-2-propenoic Acid Methyl Ester; 3-Phenylacrylic Acid Methyl Ester; Methyl 3-phenyl-2-propenoate; Methyl 3-Phenylacrylate; Methyl 3-Phenylpropenoate; Methyl Cinnamate; Methyl Cinnamylate; NSC 9411; SemaSORB 9815 |
Molecular Formula | C10H10O2 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | methyl (E)-3-phenylprop-2-enoate |
InChI | InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
InChIKey | CCRCUPLGCSFEDV-BQYQJAHWSA-N |
SMILES | COC(=O)/C=C/C1=CC=CC=C1 |