For research use only. Not for therapeutic Use.
Methyl D-Glucuronate is a methyl ester derivative of D-glucuronic acid, commonly used in biochemical research and pharmaceutical applications. This compound plays a key role in detoxification processes, as D-glucuronic acid is involved in the metabolism and excretion of various drugs and toxins through glucuronidation. Methyl D-Glucuronate is also useful in synthetic organic chemistry for creating glucuronide conjugates, making it valuable in drug design and delivery studies focused on improving bioavailability and reducing toxicity.
CAS Number | 52613-19-1 |
Synonyms | D-Glucuronic Acid Methyl Ester; D-Glucuronic Acid Methyl Ester; |
Molecular Formula | C7H12O7 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | methyl (2S,3S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
InChI | InChI=1S/C7H12O7/c1-13-7(12)5-3(9)2(8)4(10)6(11)14-5/h2-6,8-11H,1H3/t2?,3-,4+,5-,6?/m0/s1 |
InChIKey | DICCNWCUKCYGNF-CQGHMCOMSA-N |
SMILES | COC(=O)C1C(C(C(C(O1)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |