For research use only. Not for therapeutic Use.
Methyl D-Tyrosinate is an amino acid derivative that features a methyl ester of D-tyrosine. This compound is valued in biochemical research and pharmaceutical applications due to its potential to influence neurotransmitter activity and protein synthesis. Its unique structure allows it to serve as a building block for more complex peptides and bioactive molecules. Researchers often explore its role in drug development, particularly for conditions related to neurochemistry and metabolic pathways, highlighting its importance in advancing therapeutic solutions.
| Catalog Number | R044992 |
| CAS Number | 3410-66-0 |
| Synonyms | D-Tyrosine Methyl Ester |
| Molecular Formula | C10H13NO3 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate |
| InChI | InChI=1S/C10H13NO3/c1-14-10(13)9(11)6-7-2-4-8(12)5-3-7/h2-5,9,12H,6,11H2,1H3/t9-/m1/s1 |
| InChIKey | MWZPENIJLUWBSY-SECBINFHSA-N |
| SMILES | COC(=O)C(CC1=CC=C(C=C1)O)N |
