For research use only. Not for therapeutic Use.
Methyl Diethyldithiocarbamate is a chemical compound widely used in industrial and agricultural applications. Known for its role as a chelating agent and fungicide, it is essential in the synthesis of rubber accelerators and in protecting crops from fungal infections. This compound’s high purity ensures consistent and reliable results in various processes. Its applications extend to water treatment and metal ion removal, making Methyl Diethyldithiocarbamate a valuable tool in advanced chemical manufacturing and environmental management.
| Catalog Number | R046672 |
| CAS Number | 686-07-7 |
| Synonyms | N,N-Diethylcarbamodithioic Acid Methyl Ester; Diethyldithiocarbamic Acid Methyl Ester; Diethyldithiocarbamate Methyl Ester; NSC 133269; |
| Molecular Formula | C6H13NS2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl N,N-diethylcarbamodithioate |
| InChI | InChI=1S/C6H13NS2/c1-4-7(5-2)6(8)9-3/h4-5H2,1-3H3 |
| InChIKey | JYRXPFCUABYLPD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=S)SC |
