For research use only. Not for therapeutic Use.
Methyl Gallate（Cat No.:R040718）is a naturally occurring phenolic compound with antioxidant, anti-inflammatory, and antimicrobial properties. It is commonly used in pharmaceutical and cosmetic formulations due to its ability to scavenge free radicals, thus protecting cells from oxidative damage. Methyl Gallate has been studied for its potential therapeutic applications in preventing chronic diseases, such as cancer and cardiovascular disorders. Additionally, it is employed in laboratory research for its antibacterial and antifungal effects. With its diverse pharmacological activities, Methyl Gallate serves as a valuable compound in drug development and formulation.
| Catalog Number | R040718 |
| CAS Number | 99-24-1 |
| Synonyms | 3,4,5-Trihydroxybenzoic Acid Methyl Ester; Methyl 3,4,5-Trihydroxybenzoate;NSC 363001 |
| Molecular Formula | C8H8O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl 3,4,5-trihydroxybenzoate |
| InChI | InChI=1S/C8H8O5/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,9-11H,1H3 |
| InChIKey | FBSFWRHWHYMIOG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)O)O |
