For research use only. Not for therapeutic Use.
Methyl hydrazinecarbodithioate（Cat No.:L006693）, is a chemical compound consisting of a methyl hydrazine group (-NHNH2) attached to a carbodithioate moiety (-CS2). This compound plays a role in organic synthesis and chemical research. It serves as a precursor in the preparation of various sulfur-containing organic compounds and finds applications in the creation of complex molecules. Its specific structure imparts unique reactivity, making it valuable in medicinal chemistry and agrochemical research. Researchers utilize methyl hydrazinecarbodithioate as a versatile building block, contributing significantly to the development of diverse chemical products and aiding advancements in scientific research.
| CAS Number | 5397-03-5 |
| Molecular Formula | C2H6N2S2 |
| Purity | ≥95% |
| IUPAC Name | methyl N-aminocarbamodithioate |
| InChI | InChI=1S/C2H6N2S2/c1-6-2(5)4-3/h3H2,1H3,(H,4,5) |
| InChIKey | ILAXBOIRSPXAMM-UHFFFAOYSA-N |
| SMILES | CSC(=S)NN |
