For research use only. Not for therapeutic Use.
Methyl Indole-3-Carboxylate(Cat No.:R028419)is a key intermediate in organic synthesis and pharmaceutical research, particularly in the study of indole derivatives. This compound is used in the development of various bioactive molecules and has applications in medicinal chemistry for designing potential cancer therapies and other therapeutic agents. Methyl Indole-3-Carboxylate serves as a precursor for the synthesis of indole-based structures with biological activity, including antimicrobial, anti-inflammatory, and anticancer properties. Its chemical stability and versatile reactivity make it a valuable building block in both research and drug development.
CAS Number | 942-24-5 |
Synonyms | Indole-3-carboxylic Acid, Methyl Ester; 3-Methoxycarbonylindole; Methyl 1H-indole-3-carboxylate; Methyl Indole-3-carboxylate; Methyl Indolyl-3-carboxylate |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | methyl 1H-indole-3-carboxylate |
InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-6-11-9-5-3-2-4-7(8)9/h2-6,11H,1H3 |
InChIKey | QXAUTQFAWKKNLM-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CNC2=CC=CC=C21 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |