For research use only. Not for therapeutic Use.
Methyl L-histidinate(Cat No.:M048494) is a methyl ester derivative of the amino acid L-histidine, characterized by the methylation of the carboxyl group. This modification enhances the compound’s solubility and absorption properties, making it more effective in crossing biological membranes. It is primarily used in biochemical research for studying histidine’s role in biological systems, particularly in enzyme mechanisms and metal ion coordination. Additionally, methyl L-histidinate serves as a building block in peptide synthesis, where it is used to investigate peptide behaviors and properties, and in pharmaceuticals, potentially influencing drug development and delivery systems.
CAS Number | 1499-46-3 |
Molecular Formula | C7H11N3O2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | methyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate |
InChI | InChI=1S/C7H11N3O2/c1-12-7(11)6(8)2-5-3-9-4-10-5/h3-4,6H,2,8H2,1H3,(H,9,10)/t6-/m0/s1 |
InChIKey | BXRMEWOQUXOLDH-LURJTMIESA-N |
SMILES | COC(=O)C(CC1=CN=CN1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |