For research use only. Not for therapeutic Use.
Methyl Margarate-d33(Cat No.:R040152) is a highly deuterated derivative of Methyl Margarate, where thirty-three hydrogen atoms are replaced with deuterium. This extensive deuteration significantly enhances its stability and makes it an exceptional tool for mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy studies. It is particularly valuable in lipidomics and metabolic research, providing insights into fatty acid metabolism and interactions. Methyl Margarate-d33 allows for precise tracking and quantification of metabolic changes, facilitating detailed analysis in pharmaceutical development and nutritional studies, thereby contributing to a deeper understanding of biochemical pathways and molecular interactions.
CAS Number | 1219804-81-5 |
Synonyms | Methyl Margarate-d33 (CAS 1219804-81-5) is the labelled analogue of Methyl Margarate which is used in large scale biodesel production, preparation and optimization studies. |
Molecular Formula | C18H36O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-tritriacontadeuterioheptadecanoate |
InChI | InChI=1S/C18H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-2/h3-17H2,1-2H3/i1D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2 |
InChIKey | HUEBIMLTDXKIPR-SRIUXHGCSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |