For research use only. Not for therapeutic Use.
Methyl Octanoate-d15 is a fully deuterated compound featuring fifteen deuterium atoms, making it a valuable tool for advanced analytical research. This isotopically labeled ester is essential for studying metabolic pathways, lipid biosynthesis, and the environmental fate of fatty acid methyl esters. Methyl Octanoate-d15 is widely used as an internal standard in GC-MS and LC-MS applications, providing precise quantification and enhanced accuracy in complex matrices. Its stable isotope labeling ensures consistency and reliability, making it an indispensable resource for research in biochemistry, environmental science, and pharmaceutical development.
CAS Number | 1219798-91-0 |
Synonyms | Methyl Octanoate-d15 |
Molecular Formula | C9H18O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate |
InChI | InChI=1S/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3/i1D3,3D2,4D2,5D2,6D2,7D2,8D2 |
InChIKey | JGHZJRVDZXSNKQ-KBZGSAGRSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |