For research use only. Not for therapeutic Use.
Methyl Oxindole-6-carboxylate (Cat.No:R030848) is a chemical compound with diverse applications in organic synthesis. It serves as a versatile building block for the creation of various complex molecules, making it valuable in pharmaceutical and chemical research. Its unique structural features contribute to its role as a key intermediate in synthetic processes.
CAS Number | 14192-26-8 |
Synonyms | 2-Oxo-6-indolinecarboxylic Acid Methyl Ester; 6-(Methoxycarbonyl)-2-indolone |
Molecular Formula | C10H9NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 2-oxo-1,3-dihydroindole-6-carboxylate |
InChI | InChI=1S/C10H9NO3/c1-14-10(13)7-3-2-6-5-9(12)11-8(6)4-7/h2-4H,5H2,1H3,(H,11,12) |
InChIKey | YFTGUNWFFVDLNM-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC2=C(CC(=O)N2)C=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |