For research use only. Not for therapeutic Use.
Methyl perfluoro isobutyl ether(Cat No.:M042753), also known as perfluoro methyl isobutyl ether, is a fluorinated ether with a highly stable and inert molecular structure due to the presence of fluorine atoms replacing all hydrogen atoms. This chemical exhibits excellent thermal and chemical stability, low viscosity, and unique solvating properties. It is primarily used as a specialty solvent in the chemical and electronic industries due to these properties. Additionally, it has applications in refrigeration and as a heat transfer fluid. Its inert nature makes it ideal for environments requiring non-reactive conditions at elevated temperatures and pressures.
CAS Number | 163702-08-7 |
Synonyms | 2-(Difluoromethoxymethyl)-1,1,1,2,3,3,3-heptafluoropropane; Methyl perfluoroisobutyl ether |
Molecular Formula | C5H3F9O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[difluoro(methoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane |
InChI | InChI=1S/C5H3F9O/c1-15-5(13,14)2(6,3(7,8)9)4(10,11)12/h1H3 |
InChIKey | DJXNLVJQMJNEMN-UHFFFAOYSA-N |
SMILES | COC(C(C(F)(F)F)(C(F)(F)F)F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |