For research use only. Not for therapeutic Use.
Methyl pyridazine-3-carboxylate(Cat No.:L043917)is a key intermediate in organic synthesis and pharmaceutical research. Featuring a pyridazine ring with a carboxylate ester group, this compound is essential for the development of various bioactive molecules, including potential therapeutic agents. Its structure allows for versatile chemical modifications, making it valuable in the synthesis of complex heterocyclic compounds. High purity and stability ensure reliable performance in research applications, supporting medicinal chemistry efforts to design and develop innovative drugs and other fine chemicals for advanced therapeutic and industrial use.
CAS Number | 34253-02-6 |
Molecular Formula | C6H6N2O2 |
Purity | ≥95% |
IUPAC Name | methyl pyridazine-3-carboxylate |
InChI | InChI=1S/C6H6N2O2/c1-10-6(9)5-3-2-4-7-8-5/h2-4H,1H3 |
InChIKey | ITMAHDJHOXDZEL-UHFFFAOYSA-N |
SMILES | COC(=O)C1=NN=CC=C1 |