Methyl Stearate-1-13C（Cat No.:R000257） is a high-purity isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring a carbon-13 atom at the first position, this labeled version of methyl stearate is crucial for studying lipid metabolism, fatty acid pathways, and biochemical mechanisms. It enhances precision and accuracy in analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for metabolic research, drug development, and synthetic chemistry, methyl stearate-1-13C integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R000257 |
| CAS Number | 167388-13-8 |
| Synonyms | Octadecanoic-1-13C Acid Methyl Ester; |
| Molecular Formula | C19H38O2 |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | methyl (113C)octadecanoate |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3/i19+1 |
| InChIKey | HPEUJPJOZXNMSJ-QHPTYGIKSA-N |
| SMILES | CCCCCCCCCCCCCCCCC[13C](=O)OC |
