Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds> (Methyl)triphenylphosphonium Iodide-d3,13CD3
For research use only. Not for therapeutic Use.
(Methyl)triphenylphosphonium Iodide-d3,13CD3(Cat No.:R011557) is a high-purity deuterated and 13C-labeled compound, featuring three deuterium atoms and one 13C atom. This isotopically labeled reagent is essential for advanced pharmaceutical and biochemical research, particularly in mass spectrometry and NMR spectroscopy. Its precise labeling ensures minimal isotopic interference, making it ideal for tracing and quantification in complex metabolic pathways and studying reaction mechanisms. (Methyl)triphenylphosphonium Iodide-d3,13CD3 integrates seamlessly into various experimental protocols, providing reliable and reproducible results, thus serving as a crucial tool for high-precision scientific investigations and drug development.
Catalog Number | R011557 |
CAS Number | 282107-30-6 |
Synonyms | (Methyl)triphenyl-phosphonium Iodide-d3,13CD3; Triphenyl(trideuteriomethyl)phosphonium Iodide-13CD3; |
Molecular Formula | C19H18IP |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | triphenyl(trideuterio(113C)methyl)phosphanium;iodide |
InChI | InChI=1S/C19H18P.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1/i1+1D3; |
InChIKey | JNMIXMFEVJHFNY-SPZGMPHYSA-M |
SMILES | [2H][13C]([2H])([2H])[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |