For research use only. Not for therapeutic Use.
Methyl Tropate（Cat No.:L007094）, is an organic compound used in chemical research and synthesis. It is a derivative of tropine, featuring a methyl ester group (-COOCH3) on the tropane ring. Tropine derivatives are significant in medicinal chemistry due to their potential biological activities. Methyl trope is employed as a precursor in the synthesis of various alkaloids and pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block in organic chemistry, contributing to the development of new drugs and enabling the study of their pharmacological properties, essential in drug discovery and scientific research.
| Catalog Number | L007094 |
| CAS Number | 3967-53-1 |
| Molecular Formula | C10H12O3 |
| Purity | ≥95% |
| IUPAC Name | methyl 3-hydroxy-2-phenylpropanoate |
| InChI | InChI=1S/C10H12O3/c1-13-10(12)9(7-11)8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3 |
| InChIKey | OLEWRQVKIUHEJP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CO)C1=CC=CC=C1 |
