For research use only. Not for therapeutic Use.
Methyl Z-L-Alaninamide(Cat No.:L026206)is a modified amino acid derivative characterized by the presence of a methyl group and a protective Z (benzyloxycarbonyl) group. This compound is primarily used in peptide synthesis, where the Z group serves to protect the amino functionality during reactions, preventing unwanted side reactions. The presence of the methyl group enhances the molecule’s solubility in organic solvents, facilitating its use in various synthetic applications. Methyl Z-L-Alaninamide is instrumental in the stepwise construction of peptides, particularly in synthesizing complex sequences crucial for biological research and pharmaceutical development.
CAS Number | 33628-84-1 |
Molecular Formula | C12H16N2O3 |
Purity | ≥95% |
IUPAC Name | benzyl N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]carbamate |
InChI | InChI=1S/C12H16N2O3/c1-9(11(15)13-2)14-12(16)17-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,13,15)(H,14,16)/t9-/m0/s1 |
InChIKey | OGLOMKXQVPOBEP-VIFPVBQESA-N |
SMILES | CC(C(=O)NC)NC(=O)OCC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |