For research use only. Not for therapeutic Use.
Methyl(2-methylprop-2-en-1-yl)amine hydrochloride(Cat No.:L007742), is a chemical compound used in various chemical and pharmaceutical applications. It belongs to the class of amines, specifically tertiary amines, which are versatile compounds utilized in organic synthesis. The hydrochloride form enhances the compound’s stability and solubility in certain contexts. Researchers often employ this compound as a reagent in chemical reactions or as an intermediate in the synthesis of complex organic molecules.
CAS Number | 118814-96-3 |
Molecular Formula | C5H12ClN |
Purity | ≥95% |
IUPAC Name | N,2-dimethylprop-2-en-1-amine;hydrochloride |
InChI | InChI=1S/C5H11N.ClH/c1-5(2)4-6-3;/h6H,1,4H2,2-3H3;1H |
InChIKey | GCNVREMXOWMOQW-UHFFFAOYSA-N |
SMILES | CC(=C)CNC.Cl |