For research use only. Not for therapeutic Use.
Methylboronic Acid is a small organoboron compound widely used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions for the formation of carbon-carbon bonds. Its boronic acid group allows it to interact with various organic halides and pseudohalides, making it an essential reagent in pharmaceutical, agricultural, and material sciences. Methylboronic acid is also useful in molecular recognition and sensing applications due to its ability to bind with diols, sugars, and other molecules, enhancing its role in chemical and biological research.
| Catalog Number | R025955 |
| CAS Number | 13061-96-6 |
| Synonyms | Methaneboronic Acid |
| Molecular Formula | CH5BO2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | methylboronic acid |
| InChI | InChI=1S/CH5BO2/c1-2(3)4/h3-4H,1H3 |
| InChIKey | KTMKRRPZPWUYKK-UHFFFAOYSA-N |
| SMILES | B(C)(O)O |
