For research use only. Not for therapeutic Use.
Methyldimethoxysilane（Cat No.:M083711）, is an organosilicon compound used in various industrial applications. It is a colorless liquid with a chemical structure containing a silicon atom bonded to two methyl groups (CH3) and two methoxy groups (OCH3). Methyldimethoxysilane is primarily used as a silane coupling agent or silane adhesion promoter. Its chemical properties make it useful in enhancing adhesion and compatibility between organic materials, such as polymers, and inorganic surfaces, such as glass or metal. This compound is widely employed in the manufacturing of adhesives, sealants, coatings, and composites to improve the bonding and performance of materials in various industries, including construction and automotive.
| Catalog Number | M083711 |
| CAS Number | 16881-77-9 |
| Molecular Formula | C3H9O2Si |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | dimethoxy(methyl)silicon |
| InChI | InChI=1S/C3H9O2Si/c1-4-6(3)5-2/h1-3H3 |
| InChIKey | PKTOVQRKCNPVKY-UHFFFAOYSA-N |
| SMILES | CO[Si](C)OC |
