For research use only. Not for therapeutic Use.
Methylene bis-(Chlorosulfate)（Cat No.:C001008）, is a synthetic compound used as a chemical intermediate in various industrial applications. It is a colorless to pale yellow liquid with a strong odor. The compound contains two chlorine and two sulfate groups. It is primarily employed in the production of specialty chemicals, dyes, and surfactants. Methylene bis-(Chlorosulfate) exhibits reactivity due to the presence of these functional groups, making it valuable in organic synthesis.
| Catalog Number | C001008 |
| CAS Number | 92975-18-3 |
| Synonyms | S,S-Methylene Chlorosulfuric Acid Ester |
| Molecular Formula | CH₂Cl₂O₆S₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Dichloromethane (Slightly) |
| Appearance | Off-White Oil |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | bis(chlorosulfonyloxy)methane |
| InChI | InChI=1S/CH2Cl2O6S2/c2-10(4,5)8-1-9-11(3,6)7/h1H2 |
| InChIKey | GGRDHZBJMKCESK-UHFFFAOYSA-N |
| SMILES | C(OS(=O)(=O)Cl)OS(=O)(=O)Cl |
| Reference | Binderup, E., et al.: Synth. Commun., 14, 857 (1984). |
