For research use only. Not for therapeutic Use.
Methylene Blue (Cat No.:R037152), also known as 3,7-Bis(dimethylamino)phenothiazin-5-ium Chloride Hydrate, is a high-purity biological colorant that can be used in applications such as biological stains and chemical indicators.
Catalog Number | R037152 |
CAS Number | 122965-43-9 |
Synonyms | 3,7-Bis(dimethylamino)phenothiazin-5-ium Chloride Hydrate; |
Molecular Formula | C16H20ClN3OS |
Purity | 98% |
Documentation | |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;hydrate |
InChI | InChI=1S/C16H18N3S.ClH.H2O/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;/h5-10H,1-4H3;1H;1H2/q+1;;/p-1 |
InChIKey | WQVSELLRAGBDLX-UHFFFAOYSA-M |
SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.O.[Cl-] |