For research use only. Not for therapeutic Use.
Methylenebis(phosphonic dichloride)(Cat No.:M049697), is a chemical compound that belongs to the class of organophosphorus compounds. It is a colorless to pale yellow liquid with two phosphonic dichloride functional groups (–P(O)Cl2) linked by a methylene (–CH2–) bridge. This compound is primarily used as a reagent in chemical synthesis and can be involved in the modification of various organic molecules. It is employed in the production of flame retardants, pharmaceuticals, and other specialty chemicals.
CAS Number | 1499-29-2 |
Molecular Formula | CH2Cl4O2P2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bis(dichlorophosphoryl)methane |
InChI | InChI=1S/CH2Cl4O2P2/c2-8(3,6)1-9(4,5)7/h1H2 |
InChIKey | VRXYCDTWIOCJBH-UHFFFAOYSA-N |
SMILES | C(P(=O)(Cl)Cl)P(=O)(Cl)Cl |