For research use only. Not for therapeutic Use.
Methylenolactocin(Cat No.:M021692) is a natural compound known for its antibacterial properties, primarily found in certain species of plants. Structurally, it is a lactone, a type of cyclic ester, which is characterized by a methylene group linked to the lactone ring. This molecular structure contributes to its biological activity, particularly against Gram-positive bacteria. Methylenolactocin is of interest in pharmaceutical research for its potential as an alternative to traditional antibiotics, especially in an era of increasing antibiotic resistance.
CAS Number | 112923-53-2 |
Molecular Formula | C11H16O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,3R)-4-methylidene-5-oxo-2-pentyloxolane-3-carboxylic acid |
InChI | InChI=1S/C11H16O4/c1-3-4-5-6-8-9(10(12)13)7(2)11(14)15-8/h8-9H,2-6H2,1H3,(H,12,13)/t8-,9+/m0/s1 |
InChIKey | YZCRACGZKLIGLZ-DTWKUNHWSA-N |
SMILES | CCCCCC1C(C(=C)C(=O)O1)C(=O)O |