For research use only. Not for therapeutic Use.
Methylephedrine, (+)- is a derivative of ephedrine. It has been isolated from Ephedra distachya. In organic chemistry, N-methylephedrine is used as a resolving agent and as a precursor to chiral supporting electrolytes, phase-transfer catalysts, and reducing agents.
| Catalog Number | I014472 |
| CAS Number | 42151-56-4 |
| Synonyms | Methylephedrine, (+)-; (+)-N-Methylephedrine; L-(+)-Erythro-N-methylephedrine; D-N-Methylephedrine; Methylephedrine, D-;;(1S,2R)-2-(dimethylamino)-1-phenylpropan-1-ol |
| Molecular Formula | C11H17NO |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3/t9-,11-/m1/s1 |
| InChIKey | FMCGSUUBYTWNDP-MWLCHTKSSA-N |
| SMILES | O[C@H]([C@H](N(C)C)C)C1=CC=CC=C1 |
