For research use only. Not for therapeutic Use.
Methylglucamine hydrochloride（Cat No.:I032129） is a biochemical compound used in various laboratory and research applications. It is the hydrochloride salt of methylglucamine, a derivative of glucosamine. Methylglucamine hydrochloride is commonly employed as a stabilizer, buffer, or excipient in pharmaceutical formulations. It can also be utilized as a chelating agent for metal ions or as a component in diagnostic assays. The compound’s chemical properties make it useful for diverse biochemical and biomedical applications, contributing to advancements in scientific research and healthcare practices.
| CAS Number | 35564-86-4 |
| Synonyms | Meglumine hydrochloride; Meglumine HCl; Methylglucamine hydrochloride; Methylglucamine HCl |
| Molecular Formula | C7H18ClNO5 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Room Temperature |
| IUPAC Name | D-Glucitol, 1-deoxy-1-(methylamino)-, hydrochloride (1:1) |
| InChI | InChI=1S/C7H17NO5.ClH/c1-8-2-4(10)6(12)7(13)5(11)3-9;/h4-13H,2-3H2,1H3;1H/t4-,5+,6+,7+;/m0./s1 |
| InChIKey | PKPZZAVJXDZHDW-LJTMIZJLSA-N |
| SMILES | Cl.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
