For research use only. Not for therapeutic Use.
Methylglucamine hydrochloride(Cat No.:I032129) is a biochemical compound used in various laboratory and research applications. It is the hydrochloride salt of methylglucamine, a derivative of glucosamine. Methylglucamine hydrochloride is commonly employed as a stabilizer, buffer, or excipient in pharmaceutical formulations. It can also be utilized as a chelating agent for metal ions or as a component in diagnostic assays. The compound’s chemical properties make it useful for diverse biochemical and biomedical applications, contributing to advancements in scientific research and healthcare practices.
CAS Number | 35564-86-4 |
Synonyms | Meglumine hydrochloride; Meglumine HCl; Methylglucamine hydrochloride; Methylglucamine HCl |
Molecular Formula | C7H18ClNO5 |
Purity | 98% |
Solubility | To be determined |
Appearance | Solid powder |
Storage | Room Temperature |
IUPAC Name | D-Glucitol, 1-deoxy-1-(methylamino)-, hydrochloride (1:1) |
InChI | InChI=1S/C7H17NO5.ClH/c1-8-2-4(10)6(12)7(13)5(11)3-9;/h4-13H,2-3H2,1H3;1H/t4-,5+,6+,7+;/m0./s1 |
InChIKey | PKPZZAVJXDZHDW-LJTMIZJLSA-N |
SMILES | Cl.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |