For research use only. Not for therapeutic Use.
Methylhexahydrophthalic anhydride (Cat.No:M000114) is a chemical compound used in various industrial applications, including as a curing agent in epoxy resins and as a hardener in coatings and adhesives. It enhances the durability and heat resistance of these materials, making it valuable in sectors such as electronics, aerospace, and automotive industries.
CAS Number | 25550-51-0 |
Synonyms | methyl hexahydrophthalic anhydride (MHHPA);hexahydromethylphthalic anhydride;methyl-1,2-cyclohexanedicarboxylic anhydride mixture of isomers;1,3-Isobenzofurandione, hexahydromethyl-;1. Methyl Hexahydrophthalic Anhydride (MHHPA);METHYLAEXAHYDROPHTHALI |
Molecular Formula | C9H12O3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 7a-methyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
InChI | InChI=1S/C9H12O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h6H,2-5H2,1H3 |
InChIKey | VYKXQOYUCMREIS-UHFFFAOYSA-N |
SMILES | CC12CCCCC1C(=O)OC2=O |
Reference | 1: Jeppsson MC, Lindh CH, Kristiansson MH, Nielsen J, Jönsson BA. Methylhexahydrophthalic anhydride adducted albumin tryptic peptides in nasal lavage fluid. Inhal Toxicol. 2009 Oct;21(12):1013-20. doi: 10.1080/08958370802715997. PubMed PMID: 19772480.<br /> |