For research use only. Not for therapeutic Use.
Methylhydroquinone（Cat No.:R020836）, also known as Toluhydroquinone, is an organic compound derived from hydroquinone with a methyl group substituent. It appears as a white crystalline substance and is primarily used as an intermediate in the synthesis of antioxidants, pharmaceuticals, and dyes. Its chemical structure enables it to act effectively as a reducing agent and a polymerization inhibitor, particularly in the manufacturing of plastics and rubber. Methylhydroquinone also serves an essential role in the stabilization of various industrial materials by preventing oxidation that can lead to degradation and spoilage.
| Catalog Number | R020836 |
| CAS Number | 95-71-6 |
| Synonyms | 2,5-Dihydroxytoluene; 2,5-Toluenediol; 2-Methyl-1,4-benzenediol; 2-Methyl-1,4-dihydroxybenzene; 2-Methyl-1,4-hydroquinone; 2-Methyl-p-hydroquinone; 2-Methylhydroquinone; 4-Hydroxy-2-methylphenol; M-HQ; Methyl 1,4-dihydroxybenzene; Methyl-p-hydroquino |
| Molecular Formula | C7H8O2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Desiccate at -20C |
| IUPAC Name | 2-methylbenzene-1,4-diol |
| InChI | InChI=1S/C7H8O2/c1-5-4-6(8)2-3-7(5)9/h2-4,8-9H,1H3 |
| InChIKey | CNHDIAIOKMXOLK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)O)O |
