For research use only. Not for therapeutic Use.
Methylidynetri-p-phenylene triisocyanate is a highly reactive compound used extensively in polymer chemistry and materials science. Known for its role in producing rigid polyurethanes and cross-linked polymers, it is essential in developing high-performance coatings, adhesives, and foams. This compound’s high purity ensures consistent and reliable results in manufacturing processes. Its applications extend to advanced composites and industrial materials, making it a valuable tool for innovative research and product development across various scientific and industrial fields.
CAS Number | 2422-91-5 |
Synonyms | METHYLIDYNETRI-P-PHENYLENE TRIISOCYANATE;TRIPHENYLMETHANE TRIISOCYANATE;1,1’,1’’-methylidynetris(4-isocyanatobenzene);1,1’,1’’-methylidynetris[4-isocyanato-benzen;1,1’,1’’-methylidynetris[4-isocyanato-Benzene;isocyanicacid,methylidynetri-p-phenylenee |
Molecular Formula | C22H13N3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[bis(4-isocyanatophenyl)methyl]-4-isocyanatobenzene |
InChI | InChI=1S/C22H13N3O3/c26-13-23-19-7-1-16(2-8-19)22(17-3-9-20(10-4-17)24-14-27)18-5-11-21(12-6-18)25-15-28/h1-12,22H |
InChIKey | LTIKIBFTASQKMM-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)N=C=O)C3=CC=C(C=C3)N=C=O)N=C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |