For research use only. Not for therapeutic Use.
Methylisothiazolinone-d3 hydrochloride(Cat No.:S000490) is a deuterated form of methylisothiazolinone hydrochloride, where three hydrogen atoms are replaced with deuterium. Methylisothiazolinone (MIT) is a widely used preservative and biocide in various personal care products, cosmetics, and industrial applications due to its effectiveness against bacteria, fungi, and yeast. The addition of deuterium atoms in the deuterated MIT-d3 enhances the compound’s stability, making it particularly useful for detailed mechanistic and degradation studies.
CAS Number | 1329509-49-0 |
Molecular Formula | C4H3D3ClNOS |
Purity | ≥95% |
IUPAC Name | 2-(trideuteriomethyl)-1,2-thiazol-3-one;hydrochloride |
InChI | InChI=1S/C4H5NOS.ClH/c1-5-4(6)2-3-7-5;/h2-3H,1H3;1H/i1D3; |
InChIKey | SJXPQSRCFCPWQQ-NIIDSAIPSA-N |
SMILES | CN1C(=O)C=CS1.Cl |