For research use only. Not for therapeutic Use.
Methylmalonyl DL-Carnitine Chloride (Mixture of Diastereomers) is a high-purity compound essential for advanced biochemical and pharmaceutical research. This ester of carnitine plays a crucial role in studies involving metabolic pathways, particularly in disorders like methylmalonic acidemia. Its precise formulation as a mixture of diastereomers ensures comprehensive analysis and accurate results. Ideal for metabolic research and drug development, it supports various experimental setups, offering reliable performance for scientists and researchers focused on metabolic and enzymatic function studies.
CAS Number | 821794-54-1 |
Synonyms | 3-Carboxy-2-(2-carboxy-1-oxopropoxy)-N,N,N-trimethyl-1-propanaminium Chloride; |
Molecular Formula | C11H20ClNO6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [3-carboxy-2-(2-carboxypropanoyloxy)propyl]-trimethylazanium;chloride |
InChI | InChI=1S/C11H19NO6.ClH/c1-7(10(15)16)11(17)18-8(5-9(13)14)6-12(2,3)4;/h7-8H,5-6H2,1-4H3,(H-,13,14,15,16);1H |
InChIKey | GCTKNVUCBFQXAL-UHFFFAOYSA-N |
SMILES | CC(C(=O)O)C(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |