For research use only. Not for therapeutic Use.
Methylphloroglucinol is a methylated derivative of phloroglucinol, a phenolic compound with three hydroxyl groups attached to a benzene ring. It is widely used in pharmaceutical and chemical research due to its antioxidant and anti-inflammatory properties. Methylphloroglucinol is often utilized in the synthesis of bioactive molecules and serves as a key intermediate in the production of drugs, particularly for gastrointestinal disorders. Its phenolic structure allows for diverse chemical modifications, making it valuable in medicinal chemistry and related applications.
CAS Number | 88-03-9 |
Synonyms | 2-Methyl-1,3,5-benzenetriol; 2,4,6-Trihydroxytoluene; 2-Methyl-1,3,5-benzenetriol; 2-Methylphloroglucinol; NSC 112934; NSC 72168; Toluene-2,4,6-triol; |
Molecular Formula | C7H8O3 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-methylbenzene-1,3,5-triol |
InChI | InChI=1S/C7H8O3/c1-4-6(9)2-5(8)3-7(4)10/h2-3,8-10H,1H3 |
InChIKey | BPHYZRNTQNPLFI-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |