For research use only. Not for therapeutic Use.
Methyltriphenylphosphonium bromide(CAT: R040724) is a quaternary ammonium salt used as a reactant in organic synthesis and as a phase-transfer catalyst. Its mode of action involves acting as a source of the methyl cation, enabling various nucleophilic substitution reactions. It is particularly valuable in reactions involving organic compounds that are poorly soluble in aqueous media. Methyltriphenylphosphonium bromide finds applications in the synthesis of pharmaceutical intermediates, agrochemicals, and other fine chemicals.
| Catalog Number | R040724 |
| CAS Number | 1779-49-3 |
| Synonyms | M 0779; MTPPB; Triphenylmethylphosphonium Bromide; Triphenylphosphonium Methobromide; Triphenylphosphonium Methylbromide |
| Molecular Formula | C19H18BrP |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl(triphenyl)phosphanium;bromide |
| InChI | InChI=1S/C19H18P.BrH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 |
| InChIKey | LSEFCHWGJNHZNT-UHFFFAOYSA-M |
| SMILES | C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
