For research use only. Not for therapeutic Use.
Metolachlor-d11(Cat No.:C000285) is a high-purity deuterated compound essential for advanced agricultural and environmental research. This isotopically labeled version of Metolachlor, featuring eleven deuterium atoms, is crucial for studying herbicide metabolism, environmental fate, and residue analysis. Its stable isotope labeling ensures precise and reliable analytical results, making it suitable for various experimental setups. Ideal for applications in herbicide efficacy studies, soil and water contamination research, and environmental monitoring, Metolachlor-d11 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | C000285 |
CAS Number | 1632119-30-2 |
Synonyms | 2-Chloro-N-(1-methoxypropan-2-yl)-N-[3,4,5-trideuterio-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trideuteriomethyl)phenyl]acetamide; |
Molecular Formula | C₁₅H₁₁D₁₁ClNO₂ |
Purity | ≥95% |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Appearance | Colourless Oil |
Storage | 4°C |
IUPAC Name | 2-chloro-N-(1-methoxypropan-2-yl)-N-[3,4,5-trideuterio-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trideuteriomethyl)phenyl]acetamide |
InChI | InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/i1D3,2D3,5D2,6D,7D,8D |
InChIKey | WVQBLGZPHOPPFO-ZPOKHESBSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])N(C(C)COC)C(=O)CCl)C([2H])([2H])[2H])[2H] |