For research use only. Not for therapeutic Use.
Metoprine(Cat No.:R051880)is an inhibitor of the enzyme dihydrofolate reductase (DHFR), primarily known for its antiviral properties, particularly against adenoviruses and other RNA viruses. By inhibiting DHFR, metoprine disrupts folate metabolism, which is crucial for nucleotide synthesis and cell division, thereby impeding viral replication. This compound has also shown potential in cancer research due to its ability to interfere with cellular proliferation. Metoprine’s unique mechanism of action makes it a valuable tool in studying viral infections and a potential candidate for developing antiviral therapies and cancer treatments.
CAS Number | 7761-45-7 |
Synonyms | 5-(3,4-Dichlorophenyl)-6-methyl-2,4-pyrimidinediamine; 2,4-Diamino-5-(3,4-?dichlorophenyl)-6-methylpyrimidine; 2,4-Diamino-5-(3’,4’-dichlorophenyl)-?6-methylpyrimidine; BW 197U; BW 50197; DDMP; Methodichlorophen; NSC 19494; NSC 7364; SK 5265; U 197; |
Molecular Formula | C11H10Cl2N4 |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Storage | 2-8°C |
IUPAC Name | 5-(3,4-dichlorophenyl)-6-methylpyrimidine-2,4-diamine |
InChI | InChI=1S/C11H10Cl2N4/c1-5-9(10(14)17-11(15)16-5)6-2-3-7(12)8(13)4-6/h2-4H,1H3,(H4,14,15,16,17) |
InChIKey | VQJHOPSWBGJHQS-UHFFFAOYSA-N |
SMILES | CC1=C(C(=NC(=N1)N)N)C2=CC(=C(C=C2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |