For research use only. Not for therapeutic Use.
Metoprolol Acid-d5 is a deuterated analog of Metoprolol Acid, essential for advanced pharmaceutical and biomedical research. This isotopically labeled compound aids in the precise study of drug metabolism, pharmacokinetics, and beta-blocker mechanisms. Its stable isotope labeling ensures accurate mass spectrometry and NMR analysis, providing reliable and reproducible data. Ideal for research on cardiovascular diseases, hypertension, and heart failure, Metoprolol Acid-d5 enhances the understanding of its therapeutic effects and safety profile, making it indispensable for innovative drug development and clinical investigations.
CAS Number | 1215404-47-9 |
Synonyms | 4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy-d5]benzeneacetic Acid; ?4-(2-Hydroxy-3-isopropylaminopropoxy-d5)phenylacetic Acid; Atenolol Acid-d5; ?H 117/04-d5; SL 77-010-d5; |
Molecular Formula | C14H21NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetic acid |
InChI | InChI=1S/C14H21NO4/c1-10(2)15-8-12(16)9-19-13-5-3-11(4-6-13)7-14(17)18/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18)/i8D2,9D2,12D |
InChIKey | PUQIRTNPJRFRCZ-FPWSDNDASA-N |
SMILES | CC(C)NCC(COC1=CC=C(C=C1)CC(=O)O)O |