For research use only. Not for therapeutic Use.
Metoprolol-d7 hydrochloride(Cat No.:S000270) is a deuterated form of metoprolol hydrochloride, where seven hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification makes it an excellent internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. Metoprolol is a beta-blocker commonly used to treat high blood pressure, heart failure, and chest pain. The introduction of deuterium in metoprolol-d7 hydrochloride allows for more accurate pharmacokinetic and metabolic studies, providing clearer insights into the drug’s absorption, distribution, metabolism, and excretion, which aids in understanding its therapeutic effects and safety profile.
CAS Number | 1219798-61-4 |
Molecular Formula | C15H19D7ClNO3 |
Purity | ≥95% |
IUPAC Name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol;hydrochloride |
InChI | InChI=1S/C15H25NO3.ClH/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;/h4-7,12,14,16-17H,8-11H2,1-3H3;1H/i1D3,2D3,12D; |
InChIKey | UKBBZNRSHOCRNP-ODLOEXKQSA-N |
SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOC)O.Cl |