For research use only. Not for therapeutic Use.
MI-2(CAT: I000268), also known as MALT1 inhibitor, is a small molecule compound that acts as an irreversible inhibitor of MALT1 (Mucosa-associated lymphoid tissue lymphoma translocation protein 1). MALT1 is an important signaling protein involved in the activation of immune responses and the development of certain lymphomas. By inhibiting MALT1, MI-2 disrupts the downstream signaling pathways that promote the growth and survival of cancer cells. MI-2 has demonstrated an IC50 value of 5.84 uM, indicating its potency in inhibiting MALT1 activity.
CAS Number | 1047953-91-2 |
Molecular Formula | C19H17Cl3N4O3 |
Purity | ≥95% |
Target | NF-κB |
Solubility | DMSO: ≥ 46 mg/mL |
Storage | Store at -20C |
IC50 | 5.84 uM |
IUPAC Name | 2-chloro-N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]acetamide |
InChI | InChI=1S/C19H17Cl3N4O3/c1-28-8-9-29-19-24-18(12-2-7-15(21)16(22)10-12)26(25-19)14-5-3-13(4-6-14)23-17(27)11-20/h2-7,10H,8-9,11H2,1H3,(H,23,27) |
InChIKey | TWJGQZBSEMDPQP-UHFFFAOYSA-N |
SMILES | COCCOC1=NN(C(=N1)C2=CC(=C(C=C2)Cl)Cl)C3=CC=C(C=C3)NC(=O)CCl |
Reference | <br /> |