For research use only. Not for therapeutic Use.
The compound described as “3-di cyano methylidene-2,3-dihydroxythiophene-3-yidino”（Cat No.:M350774） appears to be a complex organosulfur molecule featuring a thiophene ring—a five-membered ring containing a sulfur atom. The molecule includes additional functional groups such as cyanide groups attached to a methylidene (a form of methylene with two substituents), and hydroxyl groups suggesting multifunctional activity. These chemical features indicate that the compound could potentially serve in various advanced organic synthesis applications, including as a ligand in coordination chemistry or as an intermediate in pharmaceutical manufacturing, due to its likely reactivity and ability to form diverse chemical bonds.
| Catalog Number | M350774 |
| CAS Number | 74228-25-4 |
| Molecular Formula | C11H6N2O2S |
| Purity | ≥95% |
| IUPAC Name | 2-(1,1-dioxo-1-benzothiophen-3-ylidene)propanedinitrile |
| InChI | InChI=1S/C11H6N2O2S/c12-5-8(6-13)10-7-16(14,15)11-4-2-1-3-9(10)11/h1-4H,7H2 |
| InChIKey | MIBIVAHVPBKGES-UHFFFAOYSA-N |
| SMILES | C1C(=C(C#N)C#N)C2=CC=CC=C2S1(=O)=O |
