For research use only. Not for therapeutic Use.
Micheliolide(Cat No.:I004571), is a natural sesquiterpene lactone compound with significant medicinal potential. It is known for its anti-inflammatory, anti-cancer, and anti-microbial properties. Micheliolide exhibits promising activity against various cancer types by inhibiting the growth and proliferation of cancer cells. Additionally, it has been investigated for its potential in treating inflammatory diseases due to its ability to modulate the immune response.
Catalog Number | I004571 |
CAS Number | 68370-47-8 |
Molecular Formula | C15H20O3 |
Purity | ≥95% |
Target | NF-κB |
Solubility | 10 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | (3aS,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
InChI | InChI=1S/C15H20O3/c1-8-4-5-11-9(2)14(16)18-13(11)12-10(8)6-7-15(12,3)17/h11-13,17H,2,4-7H2,1,3H3/t11-,12-,13-,15+/m0/s1 |
InChIKey | RDJAFOWISVMOJY-PWNZVWSESA-N |
SMILES | CC1=C2CCC(C2C3C(CC1)C(=C)C(=O)O3)(C)O |
Reference | <p style=/line-height:25px/> </p> |