For research use only. Not for therapeutic Use.
Microhelenin C is a sesquiterpene lactone that can be isolated from Helenium microcephalum, with antitumor activity[1].
| Catalog Number | I044912 |
| CAS Number | 63569-07-3 |
| Synonyms | [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (E)-2-methylbut-2-enoate |
| Molecular Formula | C20H26O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H26O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-14(16)9-11(3)13-7-8-15(21)20(13,17)5/h6-8,11-14,16-17H,9H2,1-5H3/b10-6+/t11-,12+,13+,14-,16-,17+,20+/m1/s1 |
| InChIKey | KUPPZVXLWANEJJ-YFVRYKHXSA-N |
| SMILES | CC=C(C)C(=O)OC1C2C(C(=O)OC2CC(C3C1(C(=O)C=C3)C)C)C |
| Reference | [1]. Y Imakura, et al. Antitumor agents XXXVI: Structural elucidation of sesquiterpene lactones microhelenins-A, B, and C, microlenin acetate, and plenolin from Helenium microcephalum. J Pharm Sci. 1980 Sep;69(9):1044-9. |
