For research use only. Not for therapeutic Use.
MIF098（Cat No.:I043367）is a small-molecule inhibitor targeting the macrophage migration inhibitory factor (MIF), a pro-inflammatory cytokine involved in various immune responses and disease processes, including cancer, autoimmune disorders, and inflammation. MIF plays a key role in regulating immune cell function and promoting tumor progression. By inhibiting MIF, MIF098 seeks to block its pro-inflammatory effects, reducing inflammation and potentially slowing tumor growth. This compound has been studied for its therapeutic potential in inflammatory diseases, cancer, and autoimmune conditions, making it a promising candidate for the development of targeted therapies.
| CAS Number | 1208448-95-6 |
| Synonyms | 3-[(3-hydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one |
| Molecular Formula | C15H13NO3 |
| Purity | ≥95% |
| IUPAC Name | 3-[(3-hydroxyphenyl)methyl]-5-methyl-1,3-benzoxazol-2-one |
| InChI | InChI=1S/C15H13NO3/c1-10-5-6-14-13(7-10)16(15(18)19-14)9-11-3-2-4-12(17)8-11/h2-8,17H,9H2,1H3 |
| InChIKey | JJXKGUBHEQGADG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=O)N2CC3=CC(=CC=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
