For research use only. Not for therapeutic Use.
MIRA-1 (Cat.No:R033001) is a chemical compound that functions as a selective activator of AMP-activated protein kinase (AMPK), a key regulator of cellular energy homeostasis. MIRA-1 has shown potential in modulating metabolic pathways and improving insulin sensitivity, making it a target for research into metabolic disorders and potential therapeutic interventions.
Catalog Number | R033001 |
CAS Number | 72835-26-8 |
Synonyms | N-(Propionyloxymethyl)maleimide; NSC 19630; 1-[(1-Oxopropoxy)methyl]-1H-pyrrole-2,5-dione |
Molecular Formula | C8H9NO4 |
Purity | ≥95% |
Target | MDM-2/p53 |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at 4°C |
IUPAC Name | (2,5-dioxopyrrol-1-yl)methyl propanoate |
InChI | InChI=1S/C8H9NO4/c1-2-8(12)13-5-9-6(10)3-4-7(9)11/h3-4H,2,5H2,1H3 |
InChIKey | YXEWPGYLMHXLPS-UHFFFAOYSA-N |
SMILES | CCC(=O)OCN1C(=O)C=CC1=O |