For research use only. Not for therapeutic Use.
Miridesap (CAT: I007991) is a small-molecule drug with antineoplastic properties. It works by selectively depleting the circulating levels of serum amyloid P component (SAP), a protein that plays a key role in the formation and stabilization of amyloid deposits in various tissues. By reducing SAP levels, miridesap enhances the recognition and clearance of amyloid deposits by the immune system, making it a potential therapeutic agent for the treatment of amyloidosis and other diseases characterized by abnormal protein deposition. In addition to its antineoplastic properties, miridesap has been shown to remove SAP from the cerebrospinal fluid, which may have implications for the treatment of certain neurological conditions.
| Catalog Number | I007991 |
| CAS Number | 224624-80-0 |
| Synonyms | Miridesap； Ro-638695；Ro 638695； Ro638695；GSK-2315698； GSK 2315698； GSK2315698；CPHPC；CPOHPC （acid form）;(2/’R)-adipoyldi-D-proline |
| Molecular Formula | C16H24N2O6 |
| Purity | ≥95% |
| Target | Amyloid β |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C16H24N2O6/c19-13(17-9-3-5-11(17)15(21)22)7-1-2-8-14(20)18-10-4-6-12(18)16(23)24/h11-12H,1-10H2,(H,21,22)(H,23,24)/t11-,12-/m1/s1 |
| InChIKey | HZLAWYIBLZNRFZ-VXGBXAGGSA-N |
| SMILES | C1CC(N(C1)C(=O)CCCCC(=O)N2CCCC2C(=O)O)C(=O)O |
| Reference | <br />1: Anti-serum amyloid P component antibodies and SAP-depleting compound for treating amyloidosis </br> 2: Molecular dissection of Alzheimer/’s disease neuropathology by depletion of serum amyloid P component |
