For research use only. Not for therapeutic Use.
Mirtazapine（Cat No.:A000984）is an antidepressant primarily used to treat major depressive disorder. It functions by enhancing central noradrenergic and serotonergic activity, which helps alleviate symptoms of depression. Mirtazapine is known for its rapid onset of action and effectiveness in improving mood, sleep, and appetite. Additionally, it has anxiolytic and sedative properties, making it suitable for patients with anxiety and insomnia. With a favorable side effect profile, including less sexual dysfunction compared to other antidepressants, Mirtazapine is a valuable option for managing depression and related conditions.
| Catalog Number | A000984 |
| CAS Number | 85650-52-8 |
| Synonyms | Remeron; 85650-52-8; Mepirzepine; Remergil; Zispin |
| Molecular Formula | C17H19N3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| InChI | InChI=1S/C17H19N3/c1-19-9-10-20-16(12-19)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)20/h2-8,16H,9-12H2,1H3 |
| InChIKey | RONZAEMNMFQXRA-UHFFFAOYSA-N |
| SMILES | CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4 |
