For research use only. Not for therapeutic Use.
Mirtazapine-d3 is a high-purity deuterated compound designed for advanced pharmaceutical and biochemical research. This isotopically labeled version of Mirtazapine is crucial for pharmacokinetic studies, metabolic profiling, and drug interaction analysis. With three deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for antidepressant research and drug development, Mirtazapine-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000018 |
| CAS Number | 1216678-68-0 |
| Molecular Formula | C17H16D3N3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | 5-(trideuteriomethyl)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| InChI | InChI=1S/C17H19N3/c1-19-9-10-20-16(12-19)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)20/h2-8,16H,9-12H2,1H3/i1D3 |
| InChIKey | RONZAEMNMFQXRA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4 |
